C16H31N3O7Si — CID 165160455
1-(2-ethoxyethyl)-3-(3-triethoxysilylpropyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 165160455) has the molecular formula C16H31N3O7Si and a molecular weight of 405.52 g/mol. Its IUPAC name is 1-(2-ethoxyethyl)-3-(3-triethoxysilylpropyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-(2-ethoxyethyl)-3-(3-triethoxysilylpropyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 165160455 |
| Molecular Formula | C16H31N3O7Si |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 1-(2-ethoxyethyl)-3-(3-triethoxysilylpropyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | CCOCCn1c(=O)[nH]c(=O)n(CCC[Si](OCC)(OCC)OCC)c1=O |
| InChI | InChI=1S/C16H31N3O7Si/c1-5-23-12-11-19-15(21)17-14(20)18(16(19)22)10-9-13-27(24-6-2,25-7-3)26-8-4/h5-13H2,1-4H3,(H,17,20,21) |
| InChIKey | AYTQJRFQBFUNAD-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 113.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|