About (2R,6R)-1-benzyl-2,6-dimethyl-4-(4-nitropyrazol-1-yl)piperidine
(2R,6R)-1-benzyl-2,6-dimethyl-4-(4-nitropyrazol-1-yl)piperidine (PubChem CID 165161671) has the molecular formula C17H22N4O2
and a molecular weight of 314.39 g/mol. Its IUPAC name is (2R,6R)-1-benzyl-2,6-dimethyl-4-(4-nitropyrazol-1-yl)piperidine.
Molecular Properties
| Compound Name | (2R,6R)-1-benzyl-2,6-dimethyl-4-(4-nitropyrazol-1-yl)piperidine |
| PubChem CID | 165161671 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | (2R,6R)-1-benzyl-2,6-dimethyl-4-(4-nitropyrazol-1-yl)piperidine |
| SMILES | C[C@@H]1CC(n2cc([N+](=O)[O-])cn2)C[C@@H](C)N1Cc1ccccc1 |
| InChI | InChI=1S/C17H22N4O2/c1-13-8-16(20-12-17(10-18-20)21(22)23)9-14(2)19(13)11-15-6-4-3-5-7-15/h3-7,10,12-14,16H,8-9,11H2,1-2H3/t13-,14-/m1/s1 |
| InChIKey | SEBFISKELJLIIS-ZIAGYGMSSA-N |
| XLogP | 3.41 |
| TPSA | 64.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2R,6R)-1-benzyl-2,6-dimethyl-4-(4-nitropyrazol-1-yl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,6R)-1-benzyl-2,6-dimethyl-4-(4-nitropyrazol-1-yl)piperidine?
The IUPAC name of (2R,6R)-1-benzyl-2,6-dimethyl-4-(4-nitropyrazol-1-yl)piperidine (CID 165161671) is (2R,6R)-1-benzyl-2,6-dimethyl-4-(4-nitropyrazol-1-yl)piperidine.
What is the SMILES notation for (2R,6R)-1-benzyl-2,6-dimethyl-4-(4-nitropyrazol-1-yl)piperidine?
The canonical SMILES for (2R,6R)-1-benzyl-2,6-dimethyl-4-(4-nitropyrazol-1-yl)piperidine is C[C@@H]1CC(n2cc([N+](=O)[O-])cn2)C[C@@H](C)N1Cc1ccccc1.
What is the InChIKey of (2R,6R)-1-benzyl-2,6-dimethyl-4-(4-nitropyrazol-1-yl)piperidine?
The InChIKey is SEBFISKELJLIIS-ZIAGYGMSSA-N. The full InChI is InChI=1S/C17H22N4O2/c1-13-8-16(20-12-17(10-18-20)21(22)23)9-14(2)19(13)11-15-6-4-3-5-7-15/h3-7,10,12-14,16H,8-9,11H2,1-2H3/t13-,14-/m1/s1.
What are the key properties of (2R,6R)-1-benzyl-2,6-dimethyl-4-(4-nitropyrazol-1-yl)piperidine?
(2R,6R)-1-benzyl-2,6-dimethyl-4-(4-nitropyrazol-1-yl)piperidine has a molecular weight of 314.39 g/mol, XLogP of 3.41, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,6R)-1-benzyl-2,6-dimethyl-4-(4-nitropyrazol-1-yl)piperidine is sourced from PubChem (CID 165161671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).