C35H26FN2S2+ — CID 165161704
1-(2,4-dimethyldibenzothiophen-3-yl)-2-(7-fluoro-2-methyldibenzothiophen-1-yl)-3-methylbenzimidazol-3-ium (PubChem CID 165161704) has the molecular formula C35H26FN2S2+ and a molecular weight of 557.74 g/mol. Its IUPAC name is 1-(2,4-dimethyldibenzothiophen-3-yl)-2-(7-fluoro-2-methyldibenzothiophen-1-yl)-3-methylbenzimidazol-3-ium.
| Compound Name | 1-(2,4-dimethyldibenzothiophen-3-yl)-2-(7-fluoro-2-methyldibenzothiophen-1-yl)-3-methylbenzimidazol-3-ium |
|---|---|
| PubChem CID | 165161704 |
| Molecular Formula | C35H26FN2S2+ |
| Molecular Weight | 557.74 g/mol |
| Exact Mass | 557.15 |
| IUPAC Name | 1-(2,4-dimethyldibenzothiophen-3-yl)-2-(7-fluoro-2-methyldibenzothiophen-1-yl)-3-methylbenzimidazol-3-ium |
| SMILES | Cc1cc2c(sc3ccccc32)c(C)c1-n1c(-c2c(C)ccc3sc4cc(F)ccc4c23)[n+](C)c2ccccc21 |
| InChI | InChI=1S/C35H26FN2S2/c1-19-13-16-29-32(24-15-14-22(36)18-30(24)39-29)31(19)35-37(4)26-10-6-7-11-27(26)38(35)33-20(2)17-25-23-9-5-8-12-28(23)40-34(25)21(33)3/h5-18H,1-4H3/q+1 |
| InChIKey | MILDTZFLLBCGCL-UHFFFAOYSA-N |
| XLogP | 9.92 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.74 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|