C16H24O2 — CID 165161753
(3E,5E,10Z)-16-methyl-1-oxacyclohexadeca-3,5,10-trien-2-one (PubChem CID 165161753) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is (3E,5E,10Z)-16-methyl-1-oxacyclohexadeca-3,5,10-trien-2-one.
| Compound Name | (3E,5E,10Z)-16-methyl-1-oxacyclohexadeca-3,5,10-trien-2-one |
|---|---|
| PubChem CID | 165161753 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (3E,5E,10Z)-16-methyl-1-oxacyclohexadeca-3,5,10-trien-2-one |
| SMILES | CC1CCCC/C=C\CCC/C=C/C=C/C(=O)O1 |
| InChI | InChI=1S/C16H24O2/c1-15-13-11-9-7-5-3-2-4-6-8-10-12-14-16(17)18-15/h3,5,8,10,12,14-15H,2,4,6-7,9,11,13H2,1H3/b5-3-,10-8+,14-12+ |
| InChIKey | NGUOKRATTBMYFF-DTZKCZIUSA-N |
| XLogP | 4.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|