C16H24O2 — CID 165161786
(5E,8E,11E)-14-propyl-1-oxacyclotetradeca-5,8,11-trien-2-one (PubChem CID 165161786) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is (5E,8E,11E)-14-propyl-1-oxacyclotetradeca-5,8,11-trien-2-one.
| Compound Name | (5E,8E,11E)-14-propyl-1-oxacyclotetradeca-5,8,11-trien-2-one |
|---|---|
| PubChem CID | 165161786 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (5E,8E,11E)-14-propyl-1-oxacyclotetradeca-5,8,11-trien-2-one |
| SMILES | CCCC1C/C=C/C/C=C/C/C=C/CCC(=O)O1 |
| InChI | InChI=1S/C16H24O2/c1-2-12-15-13-10-8-6-4-3-5-7-9-11-14-16(17)18-15/h3-4,7-10,15H,2,5-6,11-14H2,1H3/b4-3+,9-7+,10-8+ |
| InChIKey | MRZVXVBIGGWUBE-VCVUDNKTSA-N |
| XLogP | 4.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|