C27H35N5O3 — CID 165162153
N-[2-(4-hydroxy-4-methylcyclohexyl)-6-pyrrolidin-1-ylindazol-5-yl]-1-oxido-6-propan-2-ylpyridin-1-ium-2-carboxamide (PubChem CID 165162153) has the molecular formula C27H35N5O3 and a molecular weight of 477.61 g/mol. Its IUPAC name is N-[2-(4-hydroxy-4-methylcyclohexyl)-6-pyrrolidin-1-ylindazol-5-yl]-1-oxido-6-propan-2-ylpyridin-1-ium-2-carboxamide.
| Compound Name | N-[2-(4-hydroxy-4-methylcyclohexyl)-6-pyrrolidin-1-ylindazol-5-yl]-1-oxido-6-propan-2-ylpyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 165162153 |
| Molecular Formula | C27H35N5O3 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.27 |
| IUPAC Name | N-[2-(4-hydroxy-4-methylcyclohexyl)-6-pyrrolidin-1-ylindazol-5-yl]-1-oxido-6-propan-2-ylpyridin-1-ium-2-carboxamide |
| SMILES | CC(C)c1cccc(C(=O)Nc2cc3cn(C4CCC(C)(O)CC4)nc3cc2N2CCCC2)[n+]1[O-] |
| InChI | InChI=1S/C27H35N5O3/c1-18(2)23-7-6-8-24(32(23)35)26(33)28-22-15-19-17-31(20-9-11-27(3,34)12-10-20)29-21(19)16-25(22)30-13-4-5-14-30/h6-8,15-18,20,34H,4-5,9-14H2,1-3H3,(H,28,33) |
| InChIKey | RNNFDCIOHSAANV-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|