C26H28N6O3 — CID 165162159
N-[2-(4-cyclopropyl-4-hydroxycyclohexyl)-6-pyrazol-1-ylindazol-5-yl]-6-methyl-1-oxidopyridin-1-ium-2-carboxamide (PubChem CID 165162159) has the molecular formula C26H28N6O3 and a molecular weight of 472.55 g/mol. Its IUPAC name is N-[2-(4-cyclopropyl-4-hydroxycyclohexyl)-6-pyrazol-1-ylindazol-5-yl]-6-methyl-1-oxidopyridin-1-ium-2-carboxamide.
| Compound Name | N-[2-(4-cyclopropyl-4-hydroxycyclohexyl)-6-pyrazol-1-ylindazol-5-yl]-6-methyl-1-oxidopyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 165162159 |
| Molecular Formula | C26H28N6O3 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | N-[2-(4-cyclopropyl-4-hydroxycyclohexyl)-6-pyrazol-1-ylindazol-5-yl]-6-methyl-1-oxidopyridin-1-ium-2-carboxamide |
| SMILES | Cc1cccc(C(=O)Nc2cc3cn(C4CCC(O)(C5CC5)CC4)nc3cc2-n2cccn2)[n+]1[O-] |
| InChI | InChI=1S/C26H28N6O3/c1-17-4-2-5-23(32(17)35)25(33)28-22-14-18-16-31(20-8-10-26(34,11-9-20)19-6-7-19)29-21(18)15-24(22)30-13-3-12-27-30/h2-5,12-16,19-20,34H,6-11H2,1H3,(H,28,33) |
| InChIKey | GBYFDRHCISLLTI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|