C30H36F2N6O — CID 165163028
4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-[[(2R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-7-(2-propan-2-ylphenyl)pyrido[4,3-d]pyrimidine (PubChem CID 165163028) has the molecular formula C30H36F2N6O and a molecular weight of 534.66 g/mol. Its IUPAC name is 4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-[[(2R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-7-(2-propan-2-ylphenyl)pyrido[4,3-d]pyrimidine.
| Compound Name | 4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-[[(2R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-7-(2-propan-2-ylphenyl)pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 165163028 |
| Molecular Formula | C30H36F2N6O |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.29 |
| IUPAC Name | 4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-[[(2R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-7-(2-propan-2-ylphenyl)pyrido[4,3-d]pyrimidine |
| SMILES | CC(C)c1ccccc1-c1ncc2c(N3CC4CCC(C3)N4)nc(OCC34CCCN3C[C@H](F)C4)nc2c1F |
| InChI | InChI=1S/C30H36F2N6O/c1-18(2)22-6-3-4-7-23(22)26-25(32)27-24(13-33-26)28(37-15-20-8-9-21(16-37)34-20)36-29(35-27)39-17-30-10-5-11-38(30)14-19(31)12-30/h3-4,6-7,13,18-21,34H,5,8-12,14-17H2,1-2H3/t19-,20?,21?,30?/m1/s1 |
| InChIKey | NTOPCWOKHULWOW-PFKGSKKCSA-N |
| XLogP | 4.85 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |