C27H29ClF2N4O4S — CID 165163954
N-[4-[chloro(difluoro)methoxy]phenyl]-9-(2,2-dimethylpropyl)-2,2-dioxo-8-(1H-pyrazol-5-yl)-3,4,4a,9a-tetrahydro-1H-thiopyrano[3,4-b]indole-6-carboxamide (PubChem CID 165163954) has the molecular formula C27H29ClF2N4O4S and a molecular weight of 579.07 g/mol. Its IUPAC name is N-[4-[chloro(difluoro)methoxy]phenyl]-9-(2,2-dimethylpropyl)-2,2-dioxo-8-(1H-pyrazol-5-yl)-3,4,4a,9a-tetrahydro-1H-thiopyrano[3,4-b]indole-6-carboxamide.
| Compound Name | N-[4-[chloro(difluoro)methoxy]phenyl]-9-(2,2-dimethylpropyl)-2,2-dioxo-8-(1H-pyrazol-5-yl)-3,4,4a,9a-tetrahydro-1H-thiopyrano[3,4-b]indole-6-carboxamide |
|---|---|
| PubChem CID | 165163954 |
| Molecular Formula | C27H29ClF2N4O4S |
| Molecular Weight | 579.07 g/mol |
| Exact Mass | 578.16 |
| IUPAC Name | N-[4-[chloro(difluoro)methoxy]phenyl]-9-(2,2-dimethylpropyl)-2,2-dioxo-8-(1H-pyrazol-5-yl)-3,4,4a,9a-tetrahydro-1H-thiopyrano[3,4-b]indole-6-carboxamide |
| SMILES | CC(C)(C)CN1c2c(-c3ccn[nH]3)cc(C(=O)Nc3ccc(OC(F)(F)Cl)cc3)cc2C2CCS(=O)(=O)CC21 |
| InChI | InChI=1S/C27H29ClF2N4O4S/c1-26(2,3)15-34-23-14-39(36,37)11-9-19(23)20-12-16(13-21(24(20)34)22-8-10-31-33-22)25(35)32-17-4-6-18(7-5-17)38-27(28,29)30/h4-8,10,12-13,19,23H,9,11,14-15H2,1-3H3,(H,31,33)(H,32,35) |
| InChIKey | DDEDURDNAGDHFO-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.07 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|