C28H30ClF2N5O4S — CID 165163972
N-[4-[chloro(difluoro)methoxy]phenyl]-3-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-propan-2-yl-5-(1H-pyrazol-5-yl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indole-7-carboxamide (PubChem CID 165163972) has the molecular formula C28H30ClF2N5O4S and a molecular weight of 606.10 g/mol. Its IUPAC name is N-[4-[chloro(difluoro)methoxy]phenyl]-3-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-propan-2-yl-5-(1H-pyrazol-5-yl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indole-7-carboxamide.
| Compound Name | N-[4-[chloro(difluoro)methoxy]phenyl]-3-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-propan-2-yl-5-(1H-pyrazol-5-yl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indole-7-carboxamide |
|---|---|
| PubChem CID | 165163972 |
| Molecular Formula | C28H30ClF2N5O4S |
| Molecular Weight | 606.10 g/mol |
| Exact Mass | 605.17 |
| IUPAC Name | N-[4-[chloro(difluoro)methoxy]phenyl]-3-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-propan-2-yl-5-(1H-pyrazol-5-yl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indole-7-carboxamide |
| SMILES | CC(C)N1c2c(-c3ccn[nH]3)cc(C(=O)Nc3ccc(OC(F)(F)Cl)cc3)cc2C2CCC(N3CCCS3(=O)=O)C21 |
| InChI | InChI=1S/C28H30ClF2N5O4S/c1-16(2)36-25-21(20-8-9-24(26(20)36)35-12-3-13-41(35,38)39)14-17(15-22(25)23-10-11-32-34-23)27(37)33-18-4-6-19(7-5-18)40-28(29,30)31/h4-7,10-11,14-16,20,24,26H,3,8-9,12-13H2,1-2H3,(H,32,34)(H,33,37) |
| InChIKey | OWNYEYPACPIMEK-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 107.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.10 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|