C25H25ClF2N4O4S — CID 165163980
N-[4-[chloro(difluoro)methoxy]phenyl]-2,2-dioxo-9-propan-2-yl-8-(1H-pyrazol-5-yl)-3,4,4a,9a-tetrahydro-1H-thiopyrano[3,4-b]indole-6-carboxamide (PubChem CID 165163980) has the molecular formula C25H25ClF2N4O4S and a molecular weight of 551.02 g/mol. Its IUPAC name is N-[4-[chloro(difluoro)methoxy]phenyl]-2,2-dioxo-9-propan-2-yl-8-(1H-pyrazol-5-yl)-3,4,4a,9a-tetrahydro-1H-thiopyrano[3,4-b]indole-6-carboxamide.
| Compound Name | N-[4-[chloro(difluoro)methoxy]phenyl]-2,2-dioxo-9-propan-2-yl-8-(1H-pyrazol-5-yl)-3,4,4a,9a-tetrahydro-1H-thiopyrano[3,4-b]indole-6-carboxamide |
|---|---|
| PubChem CID | 165163980 |
| Molecular Formula | C25H25ClF2N4O4S |
| Molecular Weight | 551.02 g/mol |
| Exact Mass | 550.13 |
| IUPAC Name | N-[4-[chloro(difluoro)methoxy]phenyl]-2,2-dioxo-9-propan-2-yl-8-(1H-pyrazol-5-yl)-3,4,4a,9a-tetrahydro-1H-thiopyrano[3,4-b]indole-6-carboxamide |
| SMILES | CC(C)N1c2c(-c3ccn[nH]3)cc(C(=O)Nc3ccc(OC(F)(F)Cl)cc3)cc2C2CCS(=O)(=O)CC21 |
| InChI | InChI=1S/C25H25ClF2N4O4S/c1-14(2)32-22-13-37(34,35)10-8-18(22)19-11-15(12-20(23(19)32)21-7-9-29-31-21)24(33)30-16-3-5-17(6-4-16)36-25(26,27)28/h3-7,9,11-12,14,18,22H,8,10,13H2,1-2H3,(H,29,31)(H,30,33) |
| InChIKey | LUCHASBFYFYRBU-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.02 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|