About (3,3-dimethylspiro[1H-indole-2,2'-chromene]-6'-yl)-(4-fluorophenyl)methanone
(3,3-dimethylspiro[1H-indole-2,2'-chromene]-6'-yl)-(4-fluorophenyl)methanone (PubChem CID 165164632) has the molecular formula C25H20FNO2
and a molecular weight of 385.44 g/mol. Its IUPAC name is (3,3-dimethylspiro[1H-indole-2,2'-chromene]-6'-yl)-(4-fluorophenyl)methanone.
Molecular Properties
| Compound Name | (3,3-dimethylspiro[1H-indole-2,2'-chromene]-6'-yl)-(4-fluorophenyl)methanone |
| PubChem CID | 165164632 |
| Molecular Formula | C25H20FNO2 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | (3,3-dimethylspiro[1H-indole-2,2'-chromene]-6'-yl)-(4-fluorophenyl)methanone |
| SMILES | CC1(C)c2ccccc2NC12C=Cc1cc(C(=O)c3ccc(F)cc3)ccc1O2 |
| InChI | InChI=1S/C25H20FNO2/c1-24(2)20-5-3-4-6-21(20)27-25(24)14-13-17-15-18(9-12-22(17)29-25)23(28)16-7-10-19(26)11-8-16/h3-15,27H,1-2H3 |
| InChIKey | VSOSMJMKEYTGFX-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3,3-dimethylspiro[1H-indole-2,2'-chromene]-6'-yl)-(4-fluorophenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,3-dimethylspiro[1H-indole-2,2'-chromene]-6'-yl)-(4-fluorophenyl)methanone?
The IUPAC name of (3,3-dimethylspiro[1H-indole-2,2'-chromene]-6'-yl)-(4-fluorophenyl)methanone (CID 165164632) is (3,3-dimethylspiro[1H-indole-2,2'-chromene]-6'-yl)-(4-fluorophenyl)methanone.
What is the SMILES notation for (3,3-dimethylspiro[1H-indole-2,2'-chromene]-6'-yl)-(4-fluorophenyl)methanone?
The canonical SMILES for (3,3-dimethylspiro[1H-indole-2,2'-chromene]-6'-yl)-(4-fluorophenyl)methanone is CC1(C)c2ccccc2NC12C=Cc1cc(C(=O)c3ccc(F)cc3)ccc1O2.
What is the InChIKey of (3,3-dimethylspiro[1H-indole-2,2'-chromene]-6'-yl)-(4-fluorophenyl)methanone?
The InChIKey is VSOSMJMKEYTGFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H20FNO2/c1-24(2)20-5-3-4-6-21(20)27-25(24)14-13-17-15-18(9-12-22(17)29-25)23(28)16-7-10-19(26)11-8-16/h3-15,27H,1-2H3.
What are the key properties of (3,3-dimethylspiro[1H-indole-2,2'-chromene]-6'-yl)-(4-fluorophenyl)methanone?
(3,3-dimethylspiro[1H-indole-2,2'-chromene]-6'-yl)-(4-fluorophenyl)methanone has a molecular weight of 385.44 g/mol, XLogP of 5.56, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,3-dimethylspiro[1H-indole-2,2'-chromene]-6'-yl)-(4-fluorophenyl)methanone is sourced from PubChem (CID 165164632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).