About (3',3'-dimethyl-1'-phenylspiro[chromene-2,2'-indole]-6-yl)-(4-fluorophenyl)methanone
(3',3'-dimethyl-1'-phenylspiro[chromene-2,2'-indole]-6-yl)-(4-fluorophenyl)methanone (PubChem CID 165164666) has the molecular formula C31H24FNO2
and a molecular weight of 461.54 g/mol. Its IUPAC name is (3',3'-dimethyl-1'-phenylspiro[chromene-2,2'-indole]-6-yl)-(4-fluorophenyl)methanone.
Molecular Properties
| Compound Name | (3',3'-dimethyl-1'-phenylspiro[chromene-2,2'-indole]-6-yl)-(4-fluorophenyl)methanone |
| PubChem CID | 165164666 |
| Molecular Formula | C31H24FNO2 |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | (3',3'-dimethyl-1'-phenylspiro[chromene-2,2'-indole]-6-yl)-(4-fluorophenyl)methanone |
| SMILES | CC1(C)c2ccccc2N(c2ccccc2)C12C=Cc1cc(C(=O)c3ccc(F)cc3)ccc1O2 |
| InChI | InChI=1S/C31H24FNO2/c1-30(2)26-10-6-7-11-27(26)33(25-8-4-3-5-9-25)31(30)19-18-22-20-23(14-17-28(22)35-31)29(34)21-12-15-24(32)16-13-21/h3-20H,1-2H3 |
| InChIKey | XCHCBIZUIOHGTQ-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3',3'-dimethyl-1'-phenylspiro[chromene-2,2'-indole]-6-yl)-(4-fluorophenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3',3'-dimethyl-1'-phenylspiro[chromene-2,2'-indole]-6-yl)-(4-fluorophenyl)methanone?
The IUPAC name of (3',3'-dimethyl-1'-phenylspiro[chromene-2,2'-indole]-6-yl)-(4-fluorophenyl)methanone (CID 165164666) is (3',3'-dimethyl-1'-phenylspiro[chromene-2,2'-indole]-6-yl)-(4-fluorophenyl)methanone.
What is the SMILES notation for (3',3'-dimethyl-1'-phenylspiro[chromene-2,2'-indole]-6-yl)-(4-fluorophenyl)methanone?
The canonical SMILES for (3',3'-dimethyl-1'-phenylspiro[chromene-2,2'-indole]-6-yl)-(4-fluorophenyl)methanone is CC1(C)c2ccccc2N(c2ccccc2)C12C=Cc1cc(C(=O)c3ccc(F)cc3)ccc1O2.
What is the InChIKey of (3',3'-dimethyl-1'-phenylspiro[chromene-2,2'-indole]-6-yl)-(4-fluorophenyl)methanone?
The InChIKey is XCHCBIZUIOHGTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H24FNO2/c1-30(2)26-10-6-7-11-27(26)33(25-8-4-3-5-9-25)31(30)19-18-22-20-23(14-17-28(22)35-31)29(34)21-12-15-24(32)16-13-21/h3-20H,1-2H3.
What are the key properties of (3',3'-dimethyl-1'-phenylspiro[chromene-2,2'-indole]-6-yl)-(4-fluorophenyl)methanone?
(3',3'-dimethyl-1'-phenylspiro[chromene-2,2'-indole]-6-yl)-(4-fluorophenyl)methanone has a molecular weight of 461.54 g/mol, XLogP of 7.29, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3',3'-dimethyl-1'-phenylspiro[chromene-2,2'-indole]-6-yl)-(4-fluorophenyl)methanone is sourced from PubChem (CID 165164666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).