About 6'-(4-fluorobenzoyl)-3,3-dimethylspiro[1H-indole-2,2'-chromene]-5-carbonitrile
6'-(4-fluorobenzoyl)-3,3-dimethylspiro[1H-indole-2,2'-chromene]-5-carbonitrile (PubChem CID 165164692) has the molecular formula C26H19FN2O2
and a molecular weight of 410.45 g/mol. Its IUPAC name is 6'-(4-fluorobenzoyl)-3,3-dimethylspiro[1H-indole-2,2'-chromene]-5-carbonitrile.
Molecular Properties
| Compound Name | 6'-(4-fluorobenzoyl)-3,3-dimethylspiro[1H-indole-2,2'-chromene]-5-carbonitrile |
| PubChem CID | 165164692 |
| Molecular Formula | C26H19FN2O2 |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 6'-(4-fluorobenzoyl)-3,3-dimethylspiro[1H-indole-2,2'-chromene]-5-carbonitrile |
| SMILES | CC1(C)c2cc(C#N)ccc2NC12C=Cc1cc(C(=O)c3ccc(F)cc3)ccc1O2 |
| InChI | InChI=1S/C26H19FN2O2/c1-25(2)21-13-16(15-28)3-9-22(21)29-26(25)12-11-18-14-19(6-10-23(18)31-26)24(30)17-4-7-20(27)8-5-17/h3-14,29H,1-2H3 |
| InChIKey | DUQHRJQAOGYCND-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6'-(4-fluorobenzoyl)-3,3-dimethylspiro[1H-indole-2,2'-chromene]-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6'-(4-fluorobenzoyl)-3,3-dimethylspiro[1H-indole-2,2'-chromene]-5-carbonitrile?
The IUPAC name of 6'-(4-fluorobenzoyl)-3,3-dimethylspiro[1H-indole-2,2'-chromene]-5-carbonitrile (CID 165164692) is 6'-(4-fluorobenzoyl)-3,3-dimethylspiro[1H-indole-2,2'-chromene]-5-carbonitrile.
What is the SMILES notation for 6'-(4-fluorobenzoyl)-3,3-dimethylspiro[1H-indole-2,2'-chromene]-5-carbonitrile?
The canonical SMILES for 6'-(4-fluorobenzoyl)-3,3-dimethylspiro[1H-indole-2,2'-chromene]-5-carbonitrile is CC1(C)c2cc(C#N)ccc2NC12C=Cc1cc(C(=O)c3ccc(F)cc3)ccc1O2.
What is the InChIKey of 6'-(4-fluorobenzoyl)-3,3-dimethylspiro[1H-indole-2,2'-chromene]-5-carbonitrile?
The InChIKey is DUQHRJQAOGYCND-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H19FN2O2/c1-25(2)21-13-16(15-28)3-9-22(21)29-26(25)12-11-18-14-19(6-10-23(18)31-26)24(30)17-4-7-20(27)8-5-17/h3-14,29H,1-2H3.
What are the key properties of 6'-(4-fluorobenzoyl)-3,3-dimethylspiro[1H-indole-2,2'-chromene]-5-carbonitrile?
6'-(4-fluorobenzoyl)-3,3-dimethylspiro[1H-indole-2,2'-chromene]-5-carbonitrile has a molecular weight of 410.45 g/mol, XLogP of 5.43, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6'-(4-fluorobenzoyl)-3,3-dimethylspiro[1H-indole-2,2'-chromene]-5-carbonitrile is sourced from PubChem (CID 165164692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).