C27H21FN2O2 — CID 165164697
(4-fluorophenyl)-(5'-isocyano-1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-yl)methanone (PubChem CID 165164697) has the molecular formula C27H21FN2O2 and a molecular weight of 424.48 g/mol. Its IUPAC name is (4-fluorophenyl)-(5'-isocyano-1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-yl)methanone.
| Compound Name | (4-fluorophenyl)-(5'-isocyano-1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-yl)methanone |
|---|---|
| PubChem CID | 165164697 |
| Molecular Formula | C27H21FN2O2 |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | (4-fluorophenyl)-(5'-isocyano-1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-yl)methanone |
| SMILES | [C-]#[N+]c1ccc2c(c1)C(C)(C)C1(C=Cc3cc(C(=O)c4ccc(F)cc4)ccc3O1)N2C |
| InChI | InChI=1S/C27H21FN2O2/c1-26(2)22-16-21(29-3)10-11-23(22)30(4)27(26)14-13-18-15-19(7-12-24(18)32-27)25(31)17-5-8-20(28)9-6-17/h5-16H,1-2,4H3 |
| InChIKey | OOFZUTLOSAEDBU-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 33.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|