C25H21FN2O4S — CID 165164709
6'-(4-fluorobenzoyl)-3,3-dimethylspiro[1H-indole-2,2'-chromene]-5-sulfonamide (PubChem CID 165164709) has the molecular formula C25H21FN2O4S and a molecular weight of 464.52 g/mol. Its IUPAC name is 6'-(4-fluorobenzoyl)-3,3-dimethylspiro[1H-indole-2,2'-chromene]-5-sulfonamide.
| Compound Name | 6'-(4-fluorobenzoyl)-3,3-dimethylspiro[1H-indole-2,2'-chromene]-5-sulfonamide |
|---|---|
| PubChem CID | 165164709 |
| Molecular Formula | C25H21FN2O4S |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | 6'-(4-fluorobenzoyl)-3,3-dimethylspiro[1H-indole-2,2'-chromene]-5-sulfonamide |
| SMILES | CC1(C)c2cc(S(N)(=O)=O)ccc2NC12C=Cc1cc(C(=O)c3ccc(F)cc3)ccc1O2 |
| InChI | InChI=1S/C25H21FN2O4S/c1-24(2)20-14-19(33(27,30)31)8-9-21(20)28-25(24)12-11-16-13-17(5-10-22(16)32-25)23(29)15-3-6-18(26)7-4-15/h3-14,28H,1-2H3,(H2,27,30,31) |
| InChIKey | HEHCXHZGKGWWMJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |