C33H32N2O6 — CID 165164733
2-[2-(6-benzoyl-3',3'-dimethylspiro[chromene-2,2'-indole]-1'-yl)ethoxycarbonylamino]ethyl prop-2-enoate (PubChem CID 165164733) has the molecular formula C33H32N2O6 and a molecular weight of 552.63 g/mol. Its IUPAC name is 2-[2-(6-benzoyl-3',3'-dimethylspiro[chromene-2,2'-indole]-1'-yl)ethoxycarbonylamino]ethyl prop-2-enoate.
| Compound Name | 2-[2-(6-benzoyl-3',3'-dimethylspiro[chromene-2,2'-indole]-1'-yl)ethoxycarbonylamino]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 165164733 |
| Molecular Formula | C33H32N2O6 |
| Molecular Weight | 552.63 g/mol |
| Exact Mass | 552.23 |
| IUPAC Name | 2-[2-(6-benzoyl-3',3'-dimethylspiro[chromene-2,2'-indole]-1'-yl)ethoxycarbonylamino]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCNC(=O)OCCN1c2ccccc2C(C)(C)C12C=Cc1cc(C(=O)c3ccccc3)ccc1O2 |
| InChI | InChI=1S/C33H32N2O6/c1-4-29(36)39-20-18-34-31(38)40-21-19-35-27-13-9-8-12-26(27)32(2,3)33(35)17-16-24-22-25(14-15-28(24)41-33)30(37)23-10-6-5-7-11-23/h4-17,22H,1,18-21H2,2-3H3,(H,34,38) |
| InChIKey | XDGVQXUEMDBGAX-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.63 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|