C51H31N5S — CID 165165850
12-[7-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-phenyl-1,3,5-triazin-2-yl]dibenzothiophen-1-yl]-11-phenylindolo[2,3-a]carbazole (PubChem CID 165165850) has the molecular formula C51H31N5S and a molecular weight of 750.94 g/mol. Its IUPAC name is 12-[7-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-phenyl-1,3,5-triazin-2-yl]dibenzothiophen-1-yl]-11-phenylindolo[2,3-a]carbazole.
| Compound Name | 12-[7-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-phenyl-1,3,5-triazin-2-yl]dibenzothiophen-1-yl]-11-phenylindolo[2,3-a]carbazole |
|---|---|
| PubChem CID | 165165850 |
| Molecular Formula | C51H31N5S |
| Molecular Weight | 750.94 g/mol |
| Exact Mass | 750.26 |
| IUPAC Name | 12-[7-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-phenyl-1,3,5-triazin-2-yl]dibenzothiophen-1-yl]-11-phenylindolo[2,3-a]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-c3ccccc3)nc(-c3ccc4c(c3)sc3cccc(-n5c6ccccc6c6ccc7c8ccccc8n(-c8ccccc8)c7c65)c34)n2)c([2H])c1[2H] |
| InChI | InChI=1S/C51H31N5S/c1-4-15-32(16-5-1)49-52-50(33-17-6-2-7-18-33)54-51(53-49)34-27-28-40-45(31-34)57-44-26-14-25-43(46(40)44)56-42-24-13-11-22-37(42)39-30-29-38-36-21-10-12-23-41(36)55(47(38)48(39)56)35-19-8-3-9-20-35/h1-31H/i1D,4D,5D,15D,16D |
| InChIKey | WQXXLKMJEZPQEK-KTZHZIRUSA-N |
| XLogP | 13.43 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.94 |
| LogP ≤ 5 | 13.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |