C51H31N5O — CID 165165919
11-[7-[4,6-bis(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]dibenzofuran-2-yl]-5-phenylindolo[3,2-b]carbazole (PubChem CID 165165919) has the molecular formula C51H31N5O and a molecular weight of 739.90 g/mol. Its IUPAC name is 11-[7-[4,6-bis(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]dibenzofuran-2-yl]-5-phenylindolo[3,2-b]carbazole.
| Compound Name | 11-[7-[4,6-bis(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]dibenzofuran-2-yl]-5-phenylindolo[3,2-b]carbazole |
|---|---|
| PubChem CID | 165165919 |
| Molecular Formula | C51H31N5O |
| Molecular Weight | 739.90 g/mol |
| Exact Mass | 739.32 |
| IUPAC Name | 11-[7-[4,6-bis(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]dibenzofuran-2-yl]-5-phenylindolo[3,2-b]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-c3ccc4c(c3)oc3ccc(-n5c6ccccc6c6cc7c(cc65)c5ccccc5n7-c5ccccc5)cc34)nc(-c3c([2H])c([2H])c([2H])c([2H])c3[2H])n2)c([2H])c1[2H] |
| InChI | InChI=1S/C51H31N5O/c1-4-14-32(15-5-1)49-52-50(33-16-6-2-7-17-33)54-51(53-49)34-24-26-39-42-29-36(25-27-47(42)57-48(39)28-34)56-44-23-13-11-21-38(44)41-30-45-40(31-46(41)56)37-20-10-12-22-43(37)55(45)35-18-8-3-9-19-35/h1-31H/i1D,2D,4D,5D,6D,7D,14D,15D,16D,17D |
| InChIKey | JWLKCJSFYBCSGR-RIMVHXCBSA-N |
| XLogP | 12.97 |
| TPSA | 61.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.90 |
| LogP ≤ 5 | 12.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |