C22H21Cl2FN2O4 — CID 165166290
N-[3,5-dichloro-4-(3-fluoro-5-propan-2-ylphenoxy)phenyl]-2-(2,6-dioxopiperidin-4-yl)acetamide (PubChem CID 165166290) has the molecular formula C22H21Cl2FN2O4 and a molecular weight of 467.32 g/mol. Its IUPAC name is N-[3,5-dichloro-4-(3-fluoro-5-propan-2-ylphenoxy)phenyl]-2-(2,6-dioxopiperidin-4-yl)acetamide.
| Compound Name | N-[3,5-dichloro-4-(3-fluoro-5-propan-2-ylphenoxy)phenyl]-2-(2,6-dioxopiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 165166290 |
| Molecular Formula | C22H21Cl2FN2O4 |
| Molecular Weight | 467.32 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | N-[3,5-dichloro-4-(3-fluoro-5-propan-2-ylphenoxy)phenyl]-2-(2,6-dioxopiperidin-4-yl)acetamide |
| SMILES | CC(C)c1cc(F)cc(Oc2c(Cl)cc(NC(=O)CC3CC(=O)NC(=O)C3)cc2Cl)c1 |
| InChI | InChI=1S/C22H21Cl2FN2O4/c1-11(2)13-6-14(25)8-16(7-13)31-22-17(23)9-15(10-18(22)24)26-19(28)3-12-4-20(29)27-21(30)5-12/h6-12H,3-5H2,1-2H3,(H,26,28)(H,27,29,30) |
| InChIKey | FJWSZQGJPXJRTH-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.32 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|