C35H51ClN7O3P — CID 165166564
7-[4-[1-[4-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-3-methoxyphenyl]piperidin-4-yl]piperazin-1-yl]-7,7-dideuterioheptan-1-ol (PubChem CID 165166564) has the molecular formula C35H51ClN7O3P and a molecular weight of 686.28 g/mol. Its IUPAC name is 7-[4-[1-[4-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-3-methoxyphenyl]piperidin-4-yl]piperazin-1-yl]-7,7-dideuterioheptan-1-ol.
| Compound Name | 7-[4-[1-[4-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-3-methoxyphenyl]piperidin-4-yl]piperazin-1-yl]-7,7-dideuterioheptan-1-ol |
|---|---|
| PubChem CID | 165166564 |
| Molecular Formula | C35H51ClN7O3P |
| Molecular Weight | 686.28 g/mol |
| Exact Mass | 685.36 |
| IUPAC Name | 7-[4-[1-[4-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-3-methoxyphenyl]piperidin-4-yl]piperazin-1-yl]-7,7-dideuterioheptan-1-ol |
| SMILES | [2H]C([2H])(CCCCCCO)N1CCN(C2CCN(c3ccc(Nc4ncc(Cl)c(Nc5ccccc5P(C)(C)=O)n4)c(OC)c3)CC2)CC1 |
| InChI | InChI=1S/C35H51ClN7O3P/c1-46-32-25-28(42-18-15-27(16-19-42)43-22-20-41(21-23-43)17-9-5-4-6-10-24-44)13-14-30(32)39-35-37-26-29(36)34(40-35)38-31-11-7-8-12-33(31)47(2,3)45/h7-8,11-14,25-27,44H,4-6,9-10,15-24H2,1-3H3,(H2,37,38,39,40)/i17D2 |
| InChIKey | OXTFDDREWSXSHS-FBCWWBABSA-N |
| XLogP | 6.40 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.28 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|