C46H49F3IrNO3- — CID 165168013
(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;4-[4-(2,2-dimethylpropyl)phenyl]-2-(5H-naphtho[2,1-b][1]benzofuran-5-id-6-yl)-5-(trifluoromethyl)pyridine;iridium (PubChem CID 165168013) has the molecular formula C46H49F3IrNO3- and a molecular weight of 913.11 g/mol. Its IUPAC name is (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;4-[4-(2,2-dimethylpropyl)phenyl]-2-(5H-naphtho[2,1-b][1]benzofuran-5-id-6-yl)-5-(trifluoromethyl)pyridine;iridium.
| Compound Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;4-[4-(2,2-dimethylpropyl)phenyl]-2-(5H-naphtho[2,1-b][1]benzofuran-5-id-6-yl)-5-(trifluoromethyl)pyridine;iridium |
|---|---|
| PubChem CID | 165168013 |
| Molecular Formula | C46H49F3IrNO3- |
| Molecular Weight | 913.11 g/mol |
| Exact Mass | 913.33 |
| IUPAC Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;4-[4-(2,2-dimethylpropyl)phenyl]-2-(5H-naphtho[2,1-b][1]benzofuran-5-id-6-yl)-5-(trifluoromethyl)pyridine;iridium |
| SMILES | CC(C)(C)Cc1ccc(-c2cc(-c3[c-]c4ccccc4c4c3oc3ccccc34)ncc2C(F)(F)F)cc1.CCC(CC)C(=O)/C=C(\O)C(CC)CC.[Ir] |
| InChI | InChI=1S/C33H25F3NO.C13H24O2.Ir/c1-32(2,3)18-20-12-14-21(15-13-20)25-17-28(37-19-27(25)33(34,35)36)26-16-22-8-4-5-9-23(22)30-24-10-6-7-11-29(24)38-31(26)30;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h4-15,17,19H,18H2,1-3H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | LIOQEFZRVHHSBI-DZTQYQPZSA-N |
| XLogP | 13.74 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 913.11 |
| LogP ≤ 5 | 13.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|