C49H33N3 — CID 165168443
4-[4-[4-[4-[2-phenyl-6-(3-phenylphenyl)pyrimidin-4-yl]phenyl]phenyl]phenyl]isoquinoline (PubChem CID 165168443) has the molecular formula C49H33N3 and a molecular weight of 663.82 g/mol. Its IUPAC name is 4-[4-[4-[4-[2-phenyl-6-(3-phenylphenyl)pyrimidin-4-yl]phenyl]phenyl]phenyl]isoquinoline.
| Compound Name | 4-[4-[4-[4-[2-phenyl-6-(3-phenylphenyl)pyrimidin-4-yl]phenyl]phenyl]phenyl]isoquinoline |
|---|---|
| PubChem CID | 165168443 |
| Molecular Formula | C49H33N3 |
| Molecular Weight | 663.82 g/mol |
| Exact Mass | 663.27 |
| IUPAC Name | 4-[4-[4-[4-[2-phenyl-6-(3-phenylphenyl)pyrimidin-4-yl]phenyl]phenyl]phenyl]isoquinoline |
| SMILES | c1ccc(-c2cccc(-c3cc(-c4ccc(-c5ccc(-c6ccc(-c7cncc8ccccc78)cc6)cc5)cc4)nc(-c4ccccc4)n3)c2)cc1 |
| InChI | InChI=1S/C49H33N3/c1-3-10-34(11-4-1)42-15-9-16-43(30-42)48-31-47(51-49(52-48)41-12-5-2-6-13-41)40-28-24-38(25-29-40)36-20-18-35(19-21-36)37-22-26-39(27-23-37)46-33-50-32-44-14-7-8-17-45(44)46/h1-33H |
| InChIKey | KZDQYQYJWCQJDZ-UHFFFAOYSA-N |
| XLogP | 12.69 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.82 |
| LogP ≤ 5 | 12.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |