C42H38BNO2Si — CID 165169101
triphenyl-[9-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbazol-3-yl]silane (PubChem CID 165169101) has the molecular formula C42H38BNO2Si and a molecular weight of 627.67 g/mol. Its IUPAC name is triphenyl-[9-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbazol-3-yl]silane.
| Compound Name | triphenyl-[9-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbazol-3-yl]silane |
|---|---|
| PubChem CID | 165169101 |
| Molecular Formula | C42H38BNO2Si |
| Molecular Weight | 627.67 g/mol |
| Exact Mass | 627.28 |
| IUPAC Name | triphenyl-[9-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbazol-3-yl]silane |
| SMILES | CC1(C)OB(c2cccc(-n3c4ccccc4c4cc([Si](c5ccccc5)(c5ccccc5)c5ccccc5)ccc43)c2)OC1(C)C |
| InChI | InChI=1S/C42H38BNO2Si/c1-41(2)42(3,4)46-43(45-41)31-17-16-18-32(29-31)44-39-26-15-14-25-37(39)38-30-36(27-28-40(38)44)47(33-19-8-5-9-20-33,34-21-10-6-11-22-34)35-23-12-7-13-24-35/h5-30H,1-4H3 |
| InChIKey | JCUYQOYZOXOQCK-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.67 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|