C51H33N — CID 165169634
9-[3-[4-[1,2,3,4,5,6,7,8-octadeuterio-10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]phenyl]-9H-fluoren-4-yl]carbazole (PubChem CID 165169634) has the molecular formula C51H33N and a molecular weight of 672.91 g/mol. Its IUPAC name is 9-[3-[4-[1,2,3,4,5,6,7,8-octadeuterio-10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]phenyl]-9H-fluoren-4-yl]carbazole.
| Compound Name | 9-[3-[4-[1,2,3,4,5,6,7,8-octadeuterio-10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]phenyl]-9H-fluoren-4-yl]carbazole |
|---|---|
| PubChem CID | 165169634 |
| Molecular Formula | C51H33N |
| Molecular Weight | 672.91 g/mol |
| Exact Mass | 672.34 |
| IUPAC Name | 9-[3-[4-[1,2,3,4,5,6,7,8-octadeuterio-10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]phenyl]-9H-fluoren-4-yl]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c3c([2H])c([2H])c([2H])c([2H])c3c(-c3ccc(-c4ccc5c(c4-n4c6ccccc6c6ccccc64)-c4ccccc4C5)cc3)c3c([2H])c([2H])c([2H])c([2H])c23)c([2H])c1[2H] |
| InChI | InChI=1S/C51H33N/c1-2-14-34(15-3-1)48-42-20-6-8-22-44(42)49(45-23-9-7-21-43(45)48)35-28-26-33(27-29-35)39-31-30-37-32-36-16-4-5-17-38(36)50(37)51(39)52-46-24-12-10-18-40(46)41-19-11-13-25-47(41)52/h1-31H,32H2/i1D,2D,3D,6D,7D,8D,9D,14D,15D,20D,21D,22D,23D |
| InChIKey | DUYSQQAUTWLKSE-UCEWURINSA-N |
| XLogP | 13.66 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.91 |
| LogP ≤ 5 | 13.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|