C47H32O — CID 165169770
4-(9,9-dimethylfluoren-2-yl)-1-(1,2,3,4,5,6,7,8-octadeuterio-10-phenylanthracen-9-yl)dibenzofuran (PubChem CID 165169770) has the molecular formula C47H32O and a molecular weight of 620.82 g/mol. Its IUPAC name is 4-(9,9-dimethylfluoren-2-yl)-1-(1,2,3,4,5,6,7,8-octadeuterio-10-phenylanthracen-9-yl)dibenzofuran.
| Compound Name | 4-(9,9-dimethylfluoren-2-yl)-1-(1,2,3,4,5,6,7,8-octadeuterio-10-phenylanthracen-9-yl)dibenzofuran |
|---|---|
| PubChem CID | 165169770 |
| Molecular Formula | C47H32O |
| Molecular Weight | 620.82 g/mol |
| Exact Mass | 620.30 |
| IUPAC Name | 4-(9,9-dimethylfluoren-2-yl)-1-(1,2,3,4,5,6,7,8-octadeuterio-10-phenylanthracen-9-yl)dibenzofuran |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3ccc(-c4ccc5c(c4)C(C)(C)c4ccccc4-5)c4oc5ccccc5c34)c3c([2H])c([2H])c([2H])c([2H])c3c(-c3ccccc3)c2c1[2H] |
| InChI | InChI=1S/C47H32O/c1-47(2)40-22-12-10-16-32(40)33-25-24-30(28-41(33)47)31-26-27-39(45-38-21-11-13-23-42(38)48-46(31)45)44-36-19-8-6-17-34(36)43(29-14-4-3-5-15-29)35-18-7-9-20-37(35)44/h3-28H,1-2H3/i6D,7D,8D,9D,17D,18D,19D,20D |
| InChIKey | XIIGBUMCVYXIMM-DZBVGMEWSA-N |
| XLogP | 13.20 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.82 |
| LogP ≤ 5 | 13.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|