About methyl 3-(6-chloropyrazolo[3,4-d]pyrimidin-1-yl)cyclobutane-1-carboxylate
methyl 3-(6-chloropyrazolo[3,4-d]pyrimidin-1-yl)cyclobutane-1-carboxylate (PubChem CID 165171868) has the molecular formula C11H11ClN4O2
and a molecular weight of 266.69 g/mol. Its IUPAC name is methyl 3-(6-chloropyrazolo[3,4-d]pyrimidin-1-yl)cyclobutane-1-carboxylate.
Molecular Properties
| Compound Name | methyl 3-(6-chloropyrazolo[3,4-d]pyrimidin-1-yl)cyclobutane-1-carboxylate |
| PubChem CID | 165171868 |
| Molecular Formula | C11H11ClN4O2 |
| Molecular Weight | 266.69 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | methyl 3-(6-chloropyrazolo[3,4-d]pyrimidin-1-yl)cyclobutane-1-carboxylate |
| SMILES | COC(=O)C1CC(n2ncc3cnc(Cl)nc32)C1 |
| InChI | InChI=1S/C11H11ClN4O2/c1-18-10(17)6-2-8(3-6)16-9-7(5-14-16)4-13-11(12)15-9/h4-6,8H,2-3H2,1H3 |
| InChIKey | UBCMZTMDSVYSQP-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.69 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 3-(6-chloropyrazolo[3,4-d]pyrimidin-1-yl)cyclobutane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(6-chloropyrazolo[3,4-d]pyrimidin-1-yl)cyclobutane-1-carboxylate?
The IUPAC name of methyl 3-(6-chloropyrazolo[3,4-d]pyrimidin-1-yl)cyclobutane-1-carboxylate (CID 165171868) is methyl 3-(6-chloropyrazolo[3,4-d]pyrimidin-1-yl)cyclobutane-1-carboxylate.
What is the SMILES notation for methyl 3-(6-chloropyrazolo[3,4-d]pyrimidin-1-yl)cyclobutane-1-carboxylate?
The canonical SMILES for methyl 3-(6-chloropyrazolo[3,4-d]pyrimidin-1-yl)cyclobutane-1-carboxylate is COC(=O)C1CC(n2ncc3cnc(Cl)nc32)C1.
What is the InChIKey of methyl 3-(6-chloropyrazolo[3,4-d]pyrimidin-1-yl)cyclobutane-1-carboxylate?
The InChIKey is UBCMZTMDSVYSQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClN4O2/c1-18-10(17)6-2-8(3-6)16-9-7(5-14-16)4-13-11(12)15-9/h4-6,8H,2-3H2,1H3.
What are the key properties of methyl 3-(6-chloropyrazolo[3,4-d]pyrimidin-1-yl)cyclobutane-1-carboxylate?
methyl 3-(6-chloropyrazolo[3,4-d]pyrimidin-1-yl)cyclobutane-1-carboxylate has a molecular weight of 266.69 g/mol, XLogP of 1.60, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(6-chloropyrazolo[3,4-d]pyrimidin-1-yl)cyclobutane-1-carboxylate is sourced from PubChem (CID 165171868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).