C6H5ClF2N2O — CID 165172490
6-chloro-2-(2,2-difluoroethyl)pyridazin-3-one (PubChem CID 165172490) has the molecular formula C6H5ClF2N2O and a molecular weight of 194.57 g/mol. Its IUPAC name is 6-chloro-2-(2,2-difluoroethyl)pyridazin-3-one.
| Compound Name | 6-chloro-2-(2,2-difluoroethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 165172490 |
| Molecular Formula | C6H5ClF2N2O |
| Molecular Weight | 194.57 g/mol |
| Exact Mass | 194.01 |
| IUPAC Name | 6-chloro-2-(2,2-difluoroethyl)pyridazin-3-one |
| SMILES | O=c1ccc(Cl)nn1CC(F)F |
| InChI | InChI=1S/C6H5ClF2N2O/c7-4-1-2-6(12)11(10-4)3-5(8)9/h1-2,5H,3H2 |
| InChIKey | BBVQMHURFLHXFH-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.57 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |