C22H27FN8O2S — CID 165172618
4-[(10-ethyl-12-methyliminospiro[1,3,5,10,11-pentazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-4-yl)amino]-3-fluorobenzenesulfonamide (PubChem CID 165172618) has the molecular formula C22H27FN8O2S and a molecular weight of 486.58 g/mol. Its IUPAC name is 4-[(10-ethyl-12-methyliminospiro[1,3,5,10,11-pentazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-4-yl)amino]-3-fluorobenzenesulfonamide.
| Compound Name | 4-[(10-ethyl-12-methyliminospiro[1,3,5,10,11-pentazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-4-yl)amino]-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 165172618 |
| Molecular Formula | C22H27FN8O2S |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | 4-[(10-ethyl-12-methyliminospiro[1,3,5,10,11-pentazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclohexane]-4-yl)amino]-3-fluorobenzenesulfonamide |
| SMILES | CCN1N/C(=N\C)C2(CCCCC2)n2c1cc1cnc(Nc3ccc(S(N)(=O)=O)cc3F)nc12 |
| InChI | InChI=1S/C22H27FN8O2S/c1-3-30-18-11-14-13-26-21(27-17-8-7-15(12-16(17)23)34(24,32)33)28-19(14)31(18)22(20(25-2)29-30)9-5-4-6-10-22/h7-8,11-13H,3-6,9-10H2,1-2H3,(H,25,29)(H2,24,32,33)(H,26,27,28) |
| InChIKey | JTFRPNBYTCPDIF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 130.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|