C19H19N5O2 — CID 165172884
2-(ethylamino)ethyl (4E,6E,7Z,9E)-10-cyano-6-[cyano(isocyano)methylidene]-10-isocyanodeca-4,7,9-trienoate (PubChem CID 165172884) has the molecular formula C19H19N5O2 and a molecular weight of 349.39 g/mol. Its IUPAC name is 2-(ethylamino)ethyl (4E,6E,7Z,9E)-10-cyano-6-[cyano(isocyano)methylidene]-10-isocyanodeca-4,7,9-trienoate.
| Compound Name | 2-(ethylamino)ethyl (4E,6E,7Z,9E)-10-cyano-6-[cyano(isocyano)methylidene]-10-isocyanodeca-4,7,9-trienoate |
|---|---|
| PubChem CID | 165172884 |
| Molecular Formula | C19H19N5O2 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 2-(ethylamino)ethyl (4E,6E,7Z,9E)-10-cyano-6-[cyano(isocyano)methylidene]-10-isocyanodeca-4,7,9-trienoate |
| SMILES | [C-]#[N+]/C(C#N)=C/C=C\C(\C=C\CCC(=O)OCCNCC)=C(/C#N)[N+]#[C-] |
| InChI | InChI=1S/C19H19N5O2/c1-4-24-12-13-26-19(25)11-6-5-8-16(18(15-21)23-3)9-7-10-17(14-20)22-2/h5,7-10,24H,4,6,11-13H2,1H3/b8-5+,9-7-,17-10+,18-16+ |
| InChIKey | LWKZDBHGHWTYML-AZVFRWLASA-N |
| XLogP | 3.06 |
| TPSA | 94.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|