C32H36FN7O3 — CID 165173941
(E)-1-[(2R)-4-[2-(2-cyclopropyloxyethoxy)-7-(5-methylisoquinolin-4-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]-2-(isocyanomethyl)piperazin-1-yl]-4-fluorobut-2-en-1-one (PubChem CID 165173941) has the molecular formula C32H36FN7O3 and a molecular weight of 585.68 g/mol. Its IUPAC name is (E)-1-[(2R)-4-[2-(2-cyclopropyloxyethoxy)-7-(5-methylisoquinolin-4-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]-2-(isocyanomethyl)piperazin-1-yl]-4-fluorobut-2-en-1-one.
| Compound Name | (E)-1-[(2R)-4-[2-(2-cyclopropyloxyethoxy)-7-(5-methylisoquinolin-4-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]-2-(isocyanomethyl)piperazin-1-yl]-4-fluorobut-2-en-1-one |
|---|---|
| PubChem CID | 165173941 |
| Molecular Formula | C32H36FN7O3 |
| Molecular Weight | 585.68 g/mol |
| Exact Mass | 585.29 |
| IUPAC Name | (E)-1-[(2R)-4-[2-(2-cyclopropyloxyethoxy)-7-(5-methylisoquinolin-4-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]-2-(isocyanomethyl)piperazin-1-yl]-4-fluorobut-2-en-1-one |
| SMILES | [C-]#[N+]C[C@H]1CN(c2nc(OCCOC3CC3)nc3c2CCN(c2cncc4cccc(C)c24)C3)CCN1C(=O)/C=C/CF |
| InChI | InChI=1S/C32H36FN7O3/c1-22-5-3-6-23-17-35-19-28(30(22)23)38-12-10-26-27(21-38)36-32(43-16-15-42-25-8-9-25)37-31(26)39-13-14-40(24(20-39)18-34-2)29(41)7-4-11-33/h3-7,17,19,24-25H,8-16,18,20-21H2,1H3/b7-4+/t24-/m0/s1 |
| InChIKey | KXQMMLYQOAPBTK-BSBODGDASA-N |
| XLogP | 3.92 |
| TPSA | 88.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.68 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|