C35H39ClN6O3 — CID 165174314
1-[(2R)-4-[7-(8-chloronaphthalen-1-yl)-2-(2-spiro[2.4]heptan-6-yloxyethoxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]-2-(isocyanomethyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 165174314) has the molecular formula C35H39ClN6O3 and a molecular weight of 627.19 g/mol. Its IUPAC name is 1-[(2R)-4-[7-(8-chloronaphthalen-1-yl)-2-(2-spiro[2.4]heptan-6-yloxyethoxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]-2-(isocyanomethyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(2R)-4-[7-(8-chloronaphthalen-1-yl)-2-(2-spiro[2.4]heptan-6-yloxyethoxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]-2-(isocyanomethyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 165174314 |
| Molecular Formula | C35H39ClN6O3 |
| Molecular Weight | 627.19 g/mol |
| Exact Mass | 626.28 |
| IUPAC Name | 1-[(2R)-4-[7-(8-chloronaphthalen-1-yl)-2-(2-spiro[2.4]heptan-6-yloxyethoxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]-2-(isocyanomethyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | [C-]#[N+]C[C@H]1CN(c2nc(OCCOC3CCC4(CC4)C3)nc3c2CCN(c2cccc4cccc(Cl)c24)C3)CCN1C(=O)C=C |
| InChI | InChI=1S/C35H39ClN6O3/c1-3-31(43)42-17-16-41(22-25(42)21-37-2)33-27-11-15-40(30-9-5-7-24-6-4-8-28(36)32(24)30)23-29(27)38-34(39-33)45-19-18-44-26-10-12-35(20-26)13-14-35/h3-9,25-26H,1,10-23H2/t25-,26?/m0/s1 |
| InChIKey | OCQLZPWXNMCDDY-PMCHYTPCSA-N |
| XLogP | 5.70 |
| TPSA | 75.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.19 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|