C15H14F3N5O7 — CID 165174551
bis(carboxymethyl)-[[2-hydroxy-4-(1,2,4,5-tetrazin-3-yl)phenyl]methyl]azanium;2,2,2-trifluoroacetate (PubChem CID 165174551) has the molecular formula C15H14F3N5O7 and a molecular weight of 433.30 g/mol. Its IUPAC name is bis(carboxymethyl)-[[2-hydroxy-4-(1,2,4,5-tetrazin-3-yl)phenyl]methyl]azanium;2,2,2-trifluoroacetate.
| Compound Name | bis(carboxymethyl)-[[2-hydroxy-4-(1,2,4,5-tetrazin-3-yl)phenyl]methyl]azanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 165174551 |
| Molecular Formula | C15H14F3N5O7 |
| Molecular Weight | 433.30 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | bis(carboxymethyl)-[[2-hydroxy-4-(1,2,4,5-tetrazin-3-yl)phenyl]methyl]azanium;2,2,2-trifluoroacetate |
| SMILES | O=C(O)C[NH+](CC(=O)O)Cc1ccc(-c2nncnn2)cc1O.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C13H13N5O5.C2HF3O2/c19-10-3-8(13-16-14-7-15-17-13)1-2-9(10)4-18(5-11(20)21)6-12(22)23;3-2(4,5)1(6)7/h1-3,7,19H,4-6H2,(H,20,21)(H,22,23);(H,6,7) |
| InChIKey | HIFRCZBFCTURLM-UHFFFAOYSA-N |
| XLogP | -2.51 |
| TPSA | 190.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.30 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|