C16H16F3N5O7 — CID 165174554
bis(carboxymethyl)-[[2-methoxy-4-(1,2,4,5-tetrazin-3-yl)phenyl]methyl]azanium;2,2,2-trifluoroacetate (PubChem CID 165174554) has the molecular formula C16H16F3N5O7 and a molecular weight of 447.33 g/mol. Its IUPAC name is bis(carboxymethyl)-[[2-methoxy-4-(1,2,4,5-tetrazin-3-yl)phenyl]methyl]azanium;2,2,2-trifluoroacetate.
| Compound Name | bis(carboxymethyl)-[[2-methoxy-4-(1,2,4,5-tetrazin-3-yl)phenyl]methyl]azanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 165174554 |
| Molecular Formula | C16H16F3N5O7 |
| Molecular Weight | 447.33 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | bis(carboxymethyl)-[[2-methoxy-4-(1,2,4,5-tetrazin-3-yl)phenyl]methyl]azanium;2,2,2-trifluoroacetate |
| SMILES | COc1cc(-c2nncnn2)ccc1C[NH+](CC(=O)O)CC(=O)O.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C14H15N5O5.C2HF3O2/c1-24-11-4-9(14-17-15-8-16-18-14)2-3-10(11)5-19(6-12(20)21)7-13(22)23;3-2(4,5)1(6)7/h2-4,8H,5-7H2,1H3,(H,20,21)(H,22,23);(H,6,7) |
| InChIKey | AOMQPPGPUHRGJJ-UHFFFAOYSA-N |
| XLogP | -2.21 |
| TPSA | 179.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.33 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |