C22H27FN6O2 — CID 165174807
4-[[5-(2-fluoro-4-pyridinyl)-4,10-dimethyl-13-oxa-3,6,7,10-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-8-yl]amino]-1-methylcyclohexan-1-ol (PubChem CID 165174807) has the molecular formula C22H27FN6O2 and a molecular weight of 426.50 g/mol. Its IUPAC name is 4-[[5-(2-fluoro-4-pyridinyl)-4,10-dimethyl-13-oxa-3,6,7,10-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-8-yl]amino]-1-methylcyclohexan-1-ol.
| Compound Name | 4-[[5-(2-fluoro-4-pyridinyl)-4,10-dimethyl-13-oxa-3,6,7,10-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-8-yl]amino]-1-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 165174807 |
| Molecular Formula | C22H27FN6O2 |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 4-[[5-(2-fluoro-4-pyridinyl)-4,10-dimethyl-13-oxa-3,6,7,10-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-8-yl]amino]-1-methylcyclohexan-1-ol |
| SMILES | Cc1nc2c3c(c(NC4CCC(C)(O)CC4)nn2c1-c1ccnc(F)c1)N(C)CCO3 |
| InChI | InChI=1S/C22H27FN6O2/c1-13-17(14-6-9-24-16(23)12-14)29-21(25-13)19-18(28(3)10-11-31-19)20(27-29)26-15-4-7-22(2,30)8-5-15/h6,9,12,15,30H,4-5,7-8,10-11H2,1-3H3,(H,26,27) |
| InChIKey | BJXKIWDXVOLFGZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 87.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|