C15H23NO — CID 165175514
7-(1,3-dihydroisoindol-2-yl)heptan-1-ol (PubChem CID 165175514) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is 7-(1,3-dihydroisoindol-2-yl)heptan-1-ol.
| Compound Name | 7-(1,3-dihydroisoindol-2-yl)heptan-1-ol |
|---|---|
| PubChem CID | 165175514 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 7-(1,3-dihydroisoindol-2-yl)heptan-1-ol |
| SMILES | OCCCCCCCN1Cc2ccccc2C1 |
| InChI | InChI=1S/C15H23NO/c17-11-7-3-1-2-6-10-16-12-14-8-4-5-9-15(14)13-16/h4-5,8-9,17H,1-3,6-7,10-13H2 |
| InChIKey | MWPASJPLYJYWOH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|