C22H21F5N2O5 — CID 165176332
methyl 4-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxylate (PubChem CID 165176332) has the molecular formula C22H21F5N2O5 and a molecular weight of 488.41 g/mol. Its IUPAC name is methyl 4-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxylate.
| Compound Name | methyl 4-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 165176332 |
| Molecular Formula | C22H21F5N2O5 |
| Molecular Weight | 488.41 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | methyl 4-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cc(NC(=O)[C@@H]2O[C@@](C)(C(F)(F)F)[C@@H](C)[C@H]2c2ccc(F)c(F)c2OC)ccn1 |
| InChI | InChI=1S/C22H21F5N2O5/c1-10-15(12-5-6-13(23)16(24)17(12)32-3)18(34-21(10,2)22(25,26)27)19(30)29-11-7-8-28-14(9-11)20(31)33-4/h5-10,15,18H,1-4H3,(H,28,29,30)/t10-,15-,18+,21+/m0/s1 |
| InChIKey | GNDLYTZWEKXPDR-TZDAZOALSA-N |
| XLogP | 4.23 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.41 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |