C19H28N2O5 — CID 165176388
1-cyclohexylpropyl (2S)-2-[(3-hydroxy-4-methoxypyridine-2-carbonyl)amino]propanoate (PubChem CID 165176388) has the molecular formula C19H28N2O5 and a molecular weight of 364.44 g/mol. Its IUPAC name is 1-cyclohexylpropyl (2S)-2-[(3-hydroxy-4-methoxypyridine-2-carbonyl)amino]propanoate.
| Compound Name | 1-cyclohexylpropyl (2S)-2-[(3-hydroxy-4-methoxypyridine-2-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 165176388 |
| Molecular Formula | C19H28N2O5 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 1-cyclohexylpropyl (2S)-2-[(3-hydroxy-4-methoxypyridine-2-carbonyl)amino]propanoate |
| SMILES | CCC(OC(=O)[C@H](C)NC(=O)c1nccc(OC)c1O)C1CCCCC1 |
| InChI | InChI=1S/C19H28N2O5/c1-4-14(13-8-6-5-7-9-13)26-19(24)12(2)21-18(23)16-17(22)15(25-3)10-11-20-16/h10-14,22H,4-9H2,1-3H3,(H,21,23)/t12-,14?/m0/s1 |
| InChIKey | ROCGTILBXTWJKO-NBFOIZRFSA-N |
| XLogP | 2.82 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |