C22H17F3N6O4S — CID 165177248
7-methyl-8-nitro-2-[4-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]-6-(trifluoromethyl)-1,3-benzothiazin-4-one (PubChem CID 165177248) has the molecular formula C22H17F3N6O4S and a molecular weight of 518.48 g/mol. Its IUPAC name is 7-methyl-8-nitro-2-[4-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]-6-(trifluoromethyl)-1,3-benzothiazin-4-one.
| Compound Name | 7-methyl-8-nitro-2-[4-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]-6-(trifluoromethyl)-1,3-benzothiazin-4-one |
|---|---|
| PubChem CID | 165177248 |
| Molecular Formula | C22H17F3N6O4S |
| Molecular Weight | 518.48 g/mol |
| Exact Mass | 518.10 |
| IUPAC Name | 7-methyl-8-nitro-2-[4-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]-6-(trifluoromethyl)-1,3-benzothiazin-4-one |
| SMILES | Cc1c(C(F)(F)F)cc2c(=O)nc(N3CCC(c4nc(-c5cccnc5)no4)CC3)sc2c1[N+](=O)[O-] |
| InChI | InChI=1S/C22H17F3N6O4S/c1-11-15(22(23,24)25)9-14-17(16(11)31(33)34)36-21(28-19(14)32)30-7-4-12(5-8-30)20-27-18(29-35-20)13-3-2-6-26-10-13/h2-3,6,9-10,12H,4-5,7-8H2,1H3 |
| InChIKey | IZNBLCCFKBFYDG-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 128.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.48 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|