C13H13NO2 — CID 165178213
6-(1,3-dioxolan-2-ylmethyl)quinoline (PubChem CID 165178213) has the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. Its IUPAC name is 6-(1,3-dioxolan-2-ylmethyl)quinoline.
| Compound Name | 6-(1,3-dioxolan-2-ylmethyl)quinoline |
|---|---|
| PubChem CID | 165178213 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 6-(1,3-dioxolan-2-ylmethyl)quinoline |
| SMILES | c1cnc2ccc(CC3OCCO3)cc2c1 |
| InChI | InChI=1S/C13H13NO2/c1-2-11-8-10(3-4-12(11)14-5-1)9-13-15-6-7-16-13/h1-5,8,13H,6-7,9H2 |
| InChIKey | DBMGXYLXQFJYSD-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |