C19H12BrFO4 — CID 165178870
methyl (1S,3S)-3-(2-bromo-6-fluorophenyl)-1',3'-dioxospiro[cyclopropane-2,2'-indene]-1-carboxylate (PubChem CID 165178870) has the molecular formula C19H12BrFO4 and a molecular weight of 403.20 g/mol. Its IUPAC name is methyl (1S,3S)-3-(2-bromo-6-fluorophenyl)-1',3'-dioxospiro[cyclopropane-2,2'-indene]-1-carboxylate.
| Compound Name | methyl (1S,3S)-3-(2-bromo-6-fluorophenyl)-1',3'-dioxospiro[cyclopropane-2,2'-indene]-1-carboxylate |
|---|---|
| PubChem CID | 165178870 |
| Molecular Formula | C19H12BrFO4 |
| Molecular Weight | 403.20 g/mol |
| Exact Mass | 401.99 |
| IUPAC Name | methyl (1S,3S)-3-(2-bromo-6-fluorophenyl)-1',3'-dioxospiro[cyclopropane-2,2'-indene]-1-carboxylate |
| SMILES | COC(=O)[C@H]1[C@H](c2c(F)cccc2Br)C12C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C19H12BrFO4/c1-25-18(24)15-14(13-11(20)7-4-8-12(13)21)19(15)16(22)9-5-2-3-6-10(9)17(19)23/h2-8,14-15H,1H3/t14-,15+/m0/s1 |
| InChIKey | RBCBAIFXGBEFFR-LSDHHAIUSA-N |
| XLogP | 3.54 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.20 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|