About carbanide;chlororhodium(2+);2-methylpropane
carbanide;chlororhodium(2+);2-methylpropane (PubChem CID 165179050) has the molecular formula C5H12ClRh
and a molecular weight of 210.51 g/mol. Its IUPAC name is carbanide;chlororhodium(2+);2-methylpropane.
Molecular Properties
| Compound Name | carbanide;chlororhodium(2+);2-methylpropane |
| PubChem CID | 165179050 |
| Molecular Formula | C5H12ClRh |
| Molecular Weight | 210.51 g/mol |
| Exact Mass | 209.97 |
| IUPAC Name | carbanide;chlororhodium(2+);2-methylpropane |
| SMILES | C[C-](C)C.Cl[Rh+2].[CH3-] |
| InChI | InChI=1S/C4H9.CH3.ClH.Rh/c1-4(2)3;;;/h1-3H3;1H3;1H;/q2*-1;;+3/p-1 |
| InChIKey | IRTXSNWPQPIVSX-UHFFFAOYSA-M |
| XLogP | 2.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.51 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;chlororhodium(2+);2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;chlororhodium(2+);2-methylpropane?
The IUPAC name of carbanide;chlororhodium(2+);2-methylpropane (CID 165179050) is carbanide;chlororhodium(2+);2-methylpropane.
What is the SMILES notation for carbanide;chlororhodium(2+);2-methylpropane?
The canonical SMILES for carbanide;chlororhodium(2+);2-methylpropane is C[C-](C)C.Cl[Rh+2].[CH3-].
What is the InChIKey of carbanide;chlororhodium(2+);2-methylpropane?
The InChIKey is IRTXSNWPQPIVSX-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H9.CH3.ClH.Rh/c1-4(2)3;;;/h1-3H3;1H3;1H;/q2*-1;;+3/p-1.
What are the key properties of carbanide;chlororhodium(2+);2-methylpropane?
carbanide;chlororhodium(2+);2-methylpropane has a molecular weight of 210.51 g/mol, XLogP of 2.76, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;chlororhodium(2+);2-methylpropane is sourced from PubChem (CID 165179050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).