C18H16FNO2Se — CID 165179491
(3R,7aS)-6-fluoro-3-phenyl-6-phenylselanyl-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one (PubChem CID 165179491) has the molecular formula C18H16FNO2Se and a molecular weight of 376.29 g/mol. Its IUPAC name is (3R,7aS)-6-fluoro-3-phenyl-6-phenylselanyl-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one.
| Compound Name | (3R,7aS)-6-fluoro-3-phenyl-6-phenylselanyl-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 165179491 |
| Molecular Formula | C18H16FNO2Se |
| Molecular Weight | 376.29 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | (3R,7aS)-6-fluoro-3-phenyl-6-phenylselanyl-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one |
| SMILES | O=C1N2[C@H](CO[C@@H]2c2ccccc2)CC1(F)[Se]c1ccccc1 |
| InChI | InChI=1S/C18H16FNO2Se/c19-18(23-15-9-5-2-6-10-15)11-14-12-22-16(20(14)17(18)21)13-7-3-1-4-8-13/h1-10,14,16H,11-12H2/t14-,16+,18?/m0/s1 |
| InChIKey | TVHPDFHOVXDTDG-QJZXMCBYSA-N |
| XLogP | 2.01 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.29 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|