C30H46N6O3Si — CID 165179648
3-[5-[(1-methylpiperidin-4-yl)methyl]-3-(2-trimethylsilylethoxymethyl)-4,6-dihydropyrrolo[3,4-d]imidazol-2-yl]-1-(oxan-2-yl)indazol-5-ol (PubChem CID 165179648) has the molecular formula C30H46N6O3Si and a molecular weight of 566.82 g/mol. Its IUPAC name is 3-[5-[(1-methylpiperidin-4-yl)methyl]-3-(2-trimethylsilylethoxymethyl)-4,6-dihydropyrrolo[3,4-d]imidazol-2-yl]-1-(oxan-2-yl)indazol-5-ol.
| Compound Name | 3-[5-[(1-methylpiperidin-4-yl)methyl]-3-(2-trimethylsilylethoxymethyl)-4,6-dihydropyrrolo[3,4-d]imidazol-2-yl]-1-(oxan-2-yl)indazol-5-ol |
|---|---|
| PubChem CID | 165179648 |
| Molecular Formula | C30H46N6O3Si |
| Molecular Weight | 566.82 g/mol |
| Exact Mass | 566.34 |
| IUPAC Name | 3-[5-[(1-methylpiperidin-4-yl)methyl]-3-(2-trimethylsilylethoxymethyl)-4,6-dihydropyrrolo[3,4-d]imidazol-2-yl]-1-(oxan-2-yl)indazol-5-ol |
| SMILES | CN1CCC(CN2Cc3nc(-c4nn(C5CCCCO5)c5ccc(O)cc45)n(COCC[Si](C)(C)C)c3C2)CC1 |
| InChI | InChI=1S/C30H46N6O3Si/c1-33-12-10-22(11-13-33)18-34-19-25-27(20-34)35(21-38-15-16-40(2,3)4)30(31-25)29-24-17-23(37)8-9-26(24)36(32-29)28-7-5-6-14-39-28/h8-9,17,22,28,37H,5-7,10-16,18-21H2,1-4H3 |
| InChIKey | FAGBLJFVKHWPBN-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 80.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.82 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|