C22H24FN3O4 — CID 165179973
ethyl 6-acetamido-4-(4-fluoro-3-propoxyanilino)-1H-indole-2-carboxylate (PubChem CID 165179973) has the molecular formula C22H24FN3O4 and a molecular weight of 413.45 g/mol. Its IUPAC name is ethyl 6-acetamido-4-(4-fluoro-3-propoxyanilino)-1H-indole-2-carboxylate.
| Compound Name | ethyl 6-acetamido-4-(4-fluoro-3-propoxyanilino)-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 165179973 |
| Molecular Formula | C22H24FN3O4 |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | ethyl 6-acetamido-4-(4-fluoro-3-propoxyanilino)-1H-indole-2-carboxylate |
| SMILES | CCCOc1cc(Nc2cc(NC(C)=O)cc3[nH]c(C(=O)OCC)cc23)ccc1F |
| InChI | InChI=1S/C22H24FN3O4/c1-4-8-30-21-11-14(6-7-17(21)23)25-18-9-15(24-13(3)27)10-19-16(18)12-20(26-19)22(28)29-5-2/h6-7,9-12,25-26H,4-5,8H2,1-3H3,(H,24,27) |
| InChIKey | UOLYZJGUUDLWQN-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |