C9H12ClN3O5S — CID 165180184
(1S,2R,3R,4R,5S)-4-[(3-chloro-1,2,4-thiadiazol-5-yl)amino]-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octane-2,3-diol (PubChem CID 165180184) has the molecular formula C9H12ClN3O5S and a molecular weight of 309.73 g/mol. Its IUPAC name is (1S,2R,3R,4R,5S)-4-[(3-chloro-1,2,4-thiadiazol-5-yl)amino]-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octane-2,3-diol.
| Compound Name | (1S,2R,3R,4R,5S)-4-[(3-chloro-1,2,4-thiadiazol-5-yl)amino]-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octane-2,3-diol |
|---|---|
| PubChem CID | 165180184 |
| Molecular Formula | C9H12ClN3O5S |
| Molecular Weight | 309.73 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | (1S,2R,3R,4R,5S)-4-[(3-chloro-1,2,4-thiadiazol-5-yl)amino]-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octane-2,3-diol |
| SMILES | OC[C@@]12CO[C@@H](O1)[C@H](Nc1nc(Cl)ns1)[C@@H](O)[C@H]2O |
| InChI | InChI=1S/C9H12ClN3O5S/c10-7-12-8(19-13-7)11-3-4(15)5(16)9(1-14)2-17-6(3)18-9/h3-6,14-16H,1-2H2,(H,11,12,13)/t3-,4-,5-,6+,9+/m1/s1 |
| InChIKey | MIOXAZKTJBZOED-RTNIUAOWSA-N |
| XLogP | -1.19 |
| TPSA | 116.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.73 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |