C28H30F3NO6S — CID 165180207
N-[(3R,4R,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 165180207) has the molecular formula C28H30F3NO6S and a molecular weight of 565.61 g/mol. Its IUPAC name is N-[(3R,4R,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[(3R,4R,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 165180207 |
| Molecular Formula | C28H30F3NO6S |
| Molecular Weight | 565.61 g/mol |
| Exact Mass | 565.17 |
| IUPAC Name | N-[(3R,4R,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | O=S(=O)(N[C@@H]1CO[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C28H30F3NO6S/c29-28(30,31)39(33,34)32-24-19-36-25(20-35-16-21-10-4-1-5-11-21)27(38-18-23-14-8-3-9-15-23)26(24)37-17-22-12-6-2-7-13-22/h1-15,24-27,32H,16-20H2/t24-,25-,26-,27+/m1/s1 |
| InChIKey | SMHAIBJZQBQBHB-CWTOASCOSA-N |
| XLogP | 4.58 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.61 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |