C9H14ClN3O5S — CID 165180216
(2R,3R,4R,5R,6S)-5-[(3-chloro-1,2,4-thiadiazol-5-yl)amino]-2-(hydroxymethyl)-6-methoxyoxane-3,4-diol (PubChem CID 165180216) has the molecular formula C9H14ClN3O5S and a molecular weight of 311.75 g/mol. Its IUPAC name is (2R,3R,4R,5R,6S)-5-[(3-chloro-1,2,4-thiadiazol-5-yl)amino]-2-(hydroxymethyl)-6-methoxyoxane-3,4-diol.
| Compound Name | (2R,3R,4R,5R,6S)-5-[(3-chloro-1,2,4-thiadiazol-5-yl)amino]-2-(hydroxymethyl)-6-methoxyoxane-3,4-diol |
|---|---|
| PubChem CID | 165180216 |
| Molecular Formula | C9H14ClN3O5S |
| Molecular Weight | 311.75 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | (2R,3R,4R,5R,6S)-5-[(3-chloro-1,2,4-thiadiazol-5-yl)amino]-2-(hydroxymethyl)-6-methoxyoxane-3,4-diol |
| SMILES | CO[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1Nc1nc(Cl)ns1 |
| InChI | InChI=1S/C9H14ClN3O5S/c1-17-7-4(11-9-12-8(10)13-19-9)6(16)5(15)3(2-14)18-7/h3-7,14-16H,2H2,1H3,(H,11,12,13)/t3-,4-,5+,6-,7+/m1/s1 |
| InChIKey | IVSJPFLABMPDJX-ZFYZTMLRSA-N |
| XLogP | -0.94 |
| TPSA | 116.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.75 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |