C25H33F3N6O11 — CID 165180248
(2R,3R,4R,5S)-2-[2-[2-[2-[2-(2,4-dinitroanilino)ethoxy]ethoxy]ethoxy]ethoxymethyl]-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]oxane-3,4-diol (PubChem CID 165180248) has the molecular formula C25H33F3N6O11 and a molecular weight of 650.56 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-[2-[2-[2-[2-(2,4-dinitroanilino)ethoxy]ethoxy]ethoxy]ethoxymethyl]-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]oxane-3,4-diol.
| Compound Name | (2R,3R,4R,5S)-2-[2-[2-[2-[2-(2,4-dinitroanilino)ethoxy]ethoxy]ethoxy]ethoxymethyl]-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]oxane-3,4-diol |
|---|---|
| PubChem CID | 165180248 |
| Molecular Formula | C25H33F3N6O11 |
| Molecular Weight | 650.56 g/mol |
| Exact Mass | 650.22 |
| IUPAC Name | (2R,3R,4R,5S)-2-[2-[2-[2-[2-(2,4-dinitroanilino)ethoxy]ethoxy]ethoxy]ethoxymethyl]-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]oxane-3,4-diol |
| SMILES | O=[N+]([O-])c1ccc(NCCOCCOCCOCCOC[C@H]2OC[C@H](Nc3nccc(C(F)(F)F)n3)[C@@H](O)[C@H]2O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H33F3N6O11/c26-25(27,28)21-3-4-30-24(32-21)31-18-14-45-20(23(36)22(18)35)15-44-12-11-43-10-9-42-8-7-41-6-5-29-17-2-1-16(33(37)38)13-19(17)34(39)40/h1-4,13,18,20,22-23,29,35-36H,5-12,14-15H2,(H,30,31,32)/t18-,20+,22+,23-/m0/s1 |
| InChIKey | PVZRKEMWHKKQJV-WJFJTQNHSA-N |
| XLogP | 1.39 |
| TPSA | 222.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.56 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|