About ethyl (2Z)-5-(2,2-dimethylpropanoyloxy)-2-(1-tributylstannylethylidene)pentanoate
ethyl (2Z)-5-(2,2-dimethylpropanoyloxy)-2-(1-tributylstannylethylidene)pentanoate (PubChem CID 165180305) has the molecular formula C26H50O4Sn
and a molecular weight of 545.39 g/mol. Its IUPAC name is ethyl (2Z)-5-(2,2-dimethylpropanoyloxy)-2-(1-tributylstannylethylidene)pentanoate.
Molecular Properties
| Compound Name | ethyl (2Z)-5-(2,2-dimethylpropanoyloxy)-2-(1-tributylstannylethylidene)pentanoate |
| PubChem CID | 165180305 |
| Molecular Formula | C26H50O4Sn |
| Molecular Weight | 545.39 g/mol |
| Exact Mass | 546.27 |
| IUPAC Name | ethyl (2Z)-5-(2,2-dimethylpropanoyloxy)-2-(1-tributylstannylethylidene)pentanoate |
| SMILES | CCCC[Sn](CCCC)(CCCC)/C(C)=C(/CCCOC(=O)C(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C14H23O4.3C4H9.Sn/c1-6-11(12(15)17-7-2)9-8-10-18-13(16)14(3,4)5;3*1-3-4-2;/h7-10H2,1-5H3;3*1,3-4H2,2H3; |
| InChIKey | JRPKLEWOQRHTGM-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 545.39 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2Z)-5-(2,2-dimethylpropanoyloxy)-2-(1-tributylstannylethylidene)pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2Z)-5-(2,2-dimethylpropanoyloxy)-2-(1-tributylstannylethylidene)pentanoate?
The IUPAC name of ethyl (2Z)-5-(2,2-dimethylpropanoyloxy)-2-(1-tributylstannylethylidene)pentanoate (CID 165180305) is ethyl (2Z)-5-(2,2-dimethylpropanoyloxy)-2-(1-tributylstannylethylidene)pentanoate.
What is the SMILES notation for ethyl (2Z)-5-(2,2-dimethylpropanoyloxy)-2-(1-tributylstannylethylidene)pentanoate?
The canonical SMILES for ethyl (2Z)-5-(2,2-dimethylpropanoyloxy)-2-(1-tributylstannylethylidene)pentanoate is CCCC[Sn](CCCC)(CCCC)/C(C)=C(/CCCOC(=O)C(C)(C)C)C(=O)OCC.
What is the InChIKey of ethyl (2Z)-5-(2,2-dimethylpropanoyloxy)-2-(1-tributylstannylethylidene)pentanoate?
The InChIKey is JRPKLEWOQRHTGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23O4.3C4H9.Sn/c1-6-11(12(15)17-7-2)9-8-10-18-13(16)14(3,4)5;3*1-3-4-2;/h7-10H2,1-5H3;3*1,3-4H2,2H3;.
What are the key properties of ethyl (2Z)-5-(2,2-dimethylpropanoyloxy)-2-(1-tributylstannylethylidene)pentanoate?
ethyl (2Z)-5-(2,2-dimethylpropanoyloxy)-2-(1-tributylstannylethylidene)pentanoate has a molecular weight of 545.39 g/mol, XLogP of 7.62, 16 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2Z)-5-(2,2-dimethylpropanoyloxy)-2-(1-tributylstannylethylidene)pentanoate is sourced from PubChem (CID 165180305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).